C20H36O4-2 — CID 18986971
2,2-bis(2,4,4-trimethylpentan-2-yl)butanedioate (PubChem CID 18986971) has the molecular formula C20H36O4-2 and a molecular weight of 340.50 g/mol. Its IUPAC name is 2,2-bis(2,4,4-trimethylpentan-2-yl)butanedioate.
| Compound Name | 2,2-bis(2,4,4-trimethylpentan-2-yl)butanedioate |
|---|---|
| PubChem CID | 18986971 |
| Molecular Formula | C20H36O4-2 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2,2-bis(2,4,4-trimethylpentan-2-yl)butanedioate |
| SMILES | CC(C)(C)CC(C)(C)C(CC(=O)[O-])(C(=O)[O-])C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H38O4/c1-16(2,3)12-18(7,8)20(15(23)24,11-14(21)22)19(9,10)13-17(4,5)6/h11-13H2,1-10H3,(H,21,22)(H,23,24)/p-2 |
| InChIKey | QIBFMTPTQRKKPG-UHFFFAOYSA-L |
| XLogP | 2.79 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |