About 1H-pyrazole;1H-pyridin-2-one
1H-pyrazole;1H-pyridin-2-one (PubChem CID 70166724) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1H-pyrazole;1H-pyridin-2-one.
Molecular Properties
| Compound Name | 1H-pyrazole;1H-pyridin-2-one |
| PubChem CID | 70166724 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1H-pyrazole;1H-pyridin-2-one |
| SMILES | O=c1cccc[nH]1.c1cn[nH]c1 |
| InChI | InChI=1S/C5H5NO.C3H4N2/c7-5-3-1-2-4-6-5;1-2-4-5-3-1/h1-4H,(H,6,7);1-3H,(H,4,5) |
| InChIKey | YORKCBORGGOPFM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrazole;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;1H-pyridin-2-one?
The IUPAC name of 1H-pyrazole;1H-pyridin-2-one (CID 70166724) is 1H-pyrazole;1H-pyridin-2-one.
What is the SMILES notation for 1H-pyrazole;1H-pyridin-2-one?
The canonical SMILES for 1H-pyrazole;1H-pyridin-2-one is O=c1cccc[nH]1.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;1H-pyridin-2-one?
The InChIKey is YORKCBORGGOPFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO.C3H4N2/c7-5-3-1-2-4-6-5;1-2-4-5-3-1/h1-4H,(H,6,7);1-3H,(H,4,5).
What are the key properties of 1H-pyrazole;1H-pyridin-2-one?
1H-pyrazole;1H-pyridin-2-one has a molecular weight of 163.18 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;1H-pyridin-2-one is sourced from PubChem (CID 70166724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).