C11H8N2O5 — CID 701677
(10aR)-8,10a-dihydroxy-1H-chromeno[2,3-d]pyrimidine-2,4-dione (PubChem CID 701677) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is (10aR)-8,10a-dihydroxy-1H-chromeno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (10aR)-8,10a-dihydroxy-1H-chromeno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 701677 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (10aR)-8,10a-dihydroxy-1H-chromeno[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC(=O)C2=Cc3ccc(O)cc3O[C@@]2(O)N1 |
| InChI | InChI=1S/C11H8N2O5/c14-6-2-1-5-3-7-9(15)12-10(16)13-11(7,17)18-8(5)4-6/h1-4,14,17H,(H2,12,13,15,16)/t11-/m1/s1 |
| InChIKey | MBCMAJKYSIFXFC-LLVKDONJSA-N |
| XLogP | -0.35 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |