C26H27NO6 — CID 70185624
4-[(5R)-4-amino-1-(4-carboxyphenyl)-5-hydroxy-6-phenoxyhexyl]benzoic acid (PubChem CID 70185624) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-[(5R)-4-amino-1-(4-carboxyphenyl)-5-hydroxy-6-phenoxyhexyl]benzoic acid.
| Compound Name | 4-[(5R)-4-amino-1-(4-carboxyphenyl)-5-hydroxy-6-phenoxyhexyl]benzoic acid |
|---|---|
| PubChem CID | 70185624 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[(5R)-4-amino-1-(4-carboxyphenyl)-5-hydroxy-6-phenoxyhexyl]benzoic acid |
| SMILES | NC(CCC(c1ccc(C(=O)O)cc1)c1ccc(C(=O)O)cc1)[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C26H27NO6/c27-23(24(28)16-33-21-4-2-1-3-5-21)15-14-22(17-6-10-19(11-7-17)25(29)30)18-8-12-20(13-9-18)26(31)32/h1-13,22-24,28H,14-16,27H2,(H,29,30)(H,31,32)/t23?,24-/m0/s1 |
| InChIKey | PAMZNGNVJXKZIS-CGAIIQECSA-N |
| XLogP | 3.76 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |