C28H35F2NO2Si — CID 70186593
tert-butyl-[1-[4-(3,5-difluoro-4-methylphenyl)phenoxy]-4-pyridin-3-ylbutan-2-yl]oxy-dimethylsilane (PubChem CID 70186593) has the molecular formula C28H35F2NO2Si and a molecular weight of 483.68 g/mol. Its IUPAC name is tert-butyl-[1-[4-(3,5-difluoro-4-methylphenyl)phenoxy]-4-pyridin-3-ylbutan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[4-(3,5-difluoro-4-methylphenyl)phenoxy]-4-pyridin-3-ylbutan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 70186593 |
| Molecular Formula | C28H35F2NO2Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | tert-butyl-[1-[4-(3,5-difluoro-4-methylphenyl)phenoxy]-4-pyridin-3-ylbutan-2-yl]oxy-dimethylsilane |
| SMILES | Cc1c(F)cc(-c2ccc(OCC(CCc3cccnc3)O[Si](C)(C)C(C)(C)C)cc2)cc1F |
| InChI | InChI=1S/C28H35F2NO2Si/c1-20-26(29)16-23(17-27(20)30)22-10-13-24(14-11-22)32-19-25(33-34(5,6)28(2,3)4)12-9-21-8-7-15-31-18-21/h7-8,10-11,13-18,25H,9,12,19H2,1-6H3 |
| InChIKey | QKJYCKVUWPCJBX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|