C23H36BNO4Si — CID 18367604
[4-[4-[tert-butyl(dimethyl)silyl]oxy-6-pyridin-3-ylhexan-3-yl]oxyphenyl]boronic acid (PubChem CID 18367604) has the molecular formula C23H36BNO4Si and a molecular weight of 429.44 g/mol. Its IUPAC name is [4-[4-[tert-butyl(dimethyl)silyl]oxy-6-pyridin-3-ylhexan-3-yl]oxyphenyl]boronic acid.
| Compound Name | [4-[4-[tert-butyl(dimethyl)silyl]oxy-6-pyridin-3-ylhexan-3-yl]oxyphenyl]boronic acid |
|---|---|
| PubChem CID | 18367604 |
| Molecular Formula | C23H36BNO4Si |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | [4-[4-[tert-butyl(dimethyl)silyl]oxy-6-pyridin-3-ylhexan-3-yl]oxyphenyl]boronic acid |
| SMILES | CCC(Oc1ccc(B(O)O)cc1)C(CCc1cccnc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H36BNO4Si/c1-7-21(28-20-13-11-19(12-14-20)24(26)27)22(29-30(5,6)23(2,3)4)15-10-18-9-8-16-25-17-18/h8-9,11-14,16-17,21-22,26-27H,7,10,15H2,1-6H3 |
| InChIKey | VNSANZKWZWQAIS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|