C18H22Cl2N2O6 — CID 70188652
4-(2-amino-4-chloro-5-methoxyphenoxy)-2-(4-amino-2-chloro-5-methoxyphenoxy)butane-1,3-diol (PubChem CID 70188652) has the molecular formula C18H22Cl2N2O6 and a molecular weight of 433.29 g/mol. Its IUPAC name is 4-(2-amino-4-chloro-5-methoxyphenoxy)-2-(4-amino-2-chloro-5-methoxyphenoxy)butane-1,3-diol.
| Compound Name | 4-(2-amino-4-chloro-5-methoxyphenoxy)-2-(4-amino-2-chloro-5-methoxyphenoxy)butane-1,3-diol |
|---|---|
| PubChem CID | 70188652 |
| Molecular Formula | C18H22Cl2N2O6 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 4-(2-amino-4-chloro-5-methoxyphenoxy)-2-(4-amino-2-chloro-5-methoxyphenoxy)butane-1,3-diol |
| SMILES | COc1cc(OC(CO)C(O)COc2cc(OC)c(Cl)cc2N)c(Cl)cc1N |
| InChI | InChI=1S/C18H22Cl2N2O6/c1-25-14-5-17(12(22)3-9(14)19)27-8-13(24)18(7-23)28-15-6-16(26-2)11(21)4-10(15)20/h3-6,13,18,23-24H,7-8,21-22H2,1-2H3 |
| InChIKey | MCURHVZFTJDFDM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|