C24H28N4O — CID 70194279
3-amino-6,6-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-benzo[b]carbazol-11-one (PubChem CID 70194279) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-amino-6,6-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-benzo[b]carbazol-11-one.
| Compound Name | 3-amino-6,6-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-benzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 70194279 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-amino-6,6-dimethyl-8-[(4-methylpiperazin-1-yl)methyl]-5H-benzo[b]carbazol-11-one |
| SMILES | CN1CCN(Cc2ccc3c(c2)C(C)(C)c2[nH]c4cc(N)ccc4c2C3=O)CC1 |
| InChI | InChI=1S/C24H28N4O/c1-24(2)19-12-15(14-28-10-8-27(3)9-11-28)4-6-17(19)22(29)21-18-7-5-16(25)13-20(18)26-23(21)24/h4-7,12-13,26H,8-11,14,25H2,1-3H3 |
| InChIKey | JUWRYUGSAZOCEX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|