C23H21N3O4S — CID 163989311
3-amino-N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxamide (PubChem CID 163989311) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxamide.
| Compound Name | 3-amino-N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxamide |
|---|---|
| PubChem CID | 163989311 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-amino-N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-8-carboxamide |
| SMILES | CC1(C)c2cc(C(=O)NC3=CCS(=O)(=O)C3)ccc2C(=O)c2c1[nH]c1cc(N)ccc21 |
| InChI | InChI=1S/C23H21N3O4S/c1-23(2)17-9-12(22(28)25-14-7-8-31(29,30)11-14)3-5-15(17)20(27)19-16-6-4-13(24)10-18(16)26-21(19)23/h3-7,9-10,26H,8,11,24H2,1-2H3,(H,25,28) |
| InChIKey | TZENRXZIFSOOBL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|