C12H21N3O6S — CID 70195470
2-(3-amino-4-morpholin-4-ylanilino)ethanol;sulfuric acid (PubChem CID 70195470) has the molecular formula C12H21N3O6S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-(3-amino-4-morpholin-4-ylanilino)ethanol;sulfuric acid.
| Compound Name | 2-(3-amino-4-morpholin-4-ylanilino)ethanol;sulfuric acid |
|---|---|
| PubChem CID | 70195470 |
| Molecular Formula | C12H21N3O6S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(3-amino-4-morpholin-4-ylanilino)ethanol;sulfuric acid |
| SMILES | Nc1cc(NCCO)ccc1N1CCOCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C12H19N3O2.H2O4S/c13-11-9-10(14-3-6-16)1-2-12(11)15-4-7-17-8-5-15;1-5(2,3)4/h1-2,9,14,16H,3-8,13H2;(H2,1,2,3,4) |
| InChIKey | AQNQYPWXHDRLAY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|