C23H25NO5 — CID 70196036
(Z)-4-(butylamino)-4-oxobut-2-enoic acid;2-(9H-fluoren-9-yl)acetic acid (PubChem CID 70196036) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (Z)-4-(butylamino)-4-oxobut-2-enoic acid;2-(9H-fluoren-9-yl)acetic acid.
| Compound Name | (Z)-4-(butylamino)-4-oxobut-2-enoic acid;2-(9H-fluoren-9-yl)acetic acid |
|---|---|
| PubChem CID | 70196036 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (Z)-4-(butylamino)-4-oxobut-2-enoic acid;2-(9H-fluoren-9-yl)acetic acid |
| SMILES | CCCCNC(=O)/C=C\C(=O)O.O=C(O)CC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H12O2.C8H13NO3/c16-15(17)9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14;1-2-3-6-9-7(10)4-5-8(11)12/h1-8,14H,9H2,(H,16,17);4-5H,2-3,6H2,1H3,(H,9,10)(H,11,12)/b;5-4- |
| InChIKey | YUPNEMFOCVJYSF-GUHKXDMSSA-N |
| XLogP | 3.82 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|