C15H23F3N4O7 — CID 70198532
(2R,3R,4S)-3-acetamido-4-amino-2-[ethyl(ethylamino)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 70198532) has the molecular formula C15H23F3N4O7 and a molecular weight of 428.36 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-amino-2-[ethyl(ethylamino)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-amino-2-[ethyl(ethylamino)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70198532 |
| Molecular Formula | C15H23F3N4O7 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-amino-2-[ethyl(ethylamino)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCNN(CC)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N4O5.C2HF3O2/c1-4-15-17(5-2)12(19)11-10(16-7(3)18)8(14)6-9(22-11)13(20)21;3-2(4,5)1(6)7/h6,8,10-11,15H,4-5,14H2,1-3H3,(H,16,18)(H,20,21);(H,6,7)/t8-,10+,11+;/m0./s1 |
| InChIKey | WARCJYPCLZOKSJ-RUEVCVNKSA-N |
| XLogP | -0.81 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|