C15H14N2O4 — CID 70200057
1-acetyl-6-nitro-2,3,4,10-tetrahydroindeno[2,1-b]azepin-5-one (PubChem CID 70200057) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-acetyl-6-nitro-2,3,4,10-tetrahydroindeno[2,1-b]azepin-5-one.
| Compound Name | 1-acetyl-6-nitro-2,3,4,10-tetrahydroindeno[2,1-b]azepin-5-one |
|---|---|
| PubChem CID | 70200057 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-acetyl-6-nitro-2,3,4,10-tetrahydroindeno[2,1-b]azepin-5-one |
| SMILES | CC(=O)N1CCCC(=O)C2=C1Cc1cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C15H14N2O4/c1-9(18)16-7-3-6-13(19)15-12(16)8-10-4-2-5-11(14(10)15)17(20)21/h2,4-5H,3,6-8H2,1H3 |
| InChIKey | AQTPBKMEGMCTMI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|