C20H25Cl2N5O4S — CID 70200211
3-[dichloro(phenyl)methoxy]-5-[(2-methyl-3-morpholin-4-ylpropyl)carbamoylamino]-1,2-thiazole-4-carboxamide (PubChem CID 70200211) has the molecular formula C20H25Cl2N5O4S and a molecular weight of 502.42 g/mol. Its IUPAC name is 3-[dichloro(phenyl)methoxy]-5-[(2-methyl-3-morpholin-4-ylpropyl)carbamoylamino]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[dichloro(phenyl)methoxy]-5-[(2-methyl-3-morpholin-4-ylpropyl)carbamoylamino]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70200211 |
| Molecular Formula | C20H25Cl2N5O4S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3-[dichloro(phenyl)methoxy]-5-[(2-methyl-3-morpholin-4-ylpropyl)carbamoylamino]-1,2-thiazole-4-carboxamide |
| SMILES | CC(CNC(=O)Nc1snc(OC(Cl)(Cl)c2ccccc2)c1C(N)=O)CN1CCOCC1 |
| InChI | InChI=1S/C20H25Cl2N5O4S/c1-13(12-27-7-9-30-10-8-27)11-24-19(29)25-18-15(16(23)28)17(26-32-18)31-20(21,22)14-5-3-2-4-6-14/h2-6,13H,7-12H2,1H3,(H2,23,28)(H2,24,25,29) |
| InChIKey | IORCQIOVSPEGHR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|