C17H20N4O4S2 — CID 18550940
4-[[4-carbamoyl-5-(2-methylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid (PubChem CID 18550940) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-[[4-carbamoyl-5-(2-methylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[4-carbamoyl-5-(2-methylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 18550940 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 4-[[4-carbamoyl-5-(2-methylpropylcarbamoylamino)-1,2-thiazol-3-yl]-sulfanylmethyl]benzoic acid |
| SMILES | CC(C)CNC(=O)Nc1snc(C(S)c2ccc(C(=O)O)cc2)c1C(N)=O |
| InChI | InChI=1S/C17H20N4O4S2/c1-8(2)7-19-17(25)20-15-11(14(18)22)12(21-27-15)13(26)9-3-5-10(6-4-9)16(23)24/h3-6,8,13,26H,7H2,1-2H3,(H2,18,22)(H,23,24)(H2,19,20,25) |
| InChIKey | ZHAIQFPQJQJFAF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|