C22H19Cl2NO4S — CID 70200960
2-(2-benzylsulfanylethyl)-4-(2,6-dichlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 70200960) has the molecular formula C22H19Cl2NO4S and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-(2-benzylsulfanylethyl)-4-(2,6-dichlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-(2-benzylsulfanylethyl)-4-(2,6-dichlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70200960 |
| Molecular Formula | C22H19Cl2NO4S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-(2-benzylsulfanylethyl)-4-(2,6-dichlorophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1=CNC(CCSCc2ccccc2)=C(C(=O)O)C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H19Cl2NO4S/c23-15-7-4-8-16(24)19(15)18-14(21(26)27)11-25-17(20(18)22(28)29)9-10-30-12-13-5-2-1-3-6-13/h1-8,11,18,25H,9-10,12H2,(H,26,27)(H,28,29) |
| InChIKey | FEOFSNQNJRAFSG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|