C13H22N4O2 — CID 70202505
ethyl 4-(4,5-diamino-2H-pyridin-1-yl)piperidine-1-carboxylate (PubChem CID 70202505) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 4-(4,5-diamino-2H-pyridin-1-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4,5-diamino-2H-pyridin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70202505 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethyl 4-(4,5-diamino-2H-pyridin-1-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C=C(N)C(N)=CC2)CC1 |
| InChI | InChI=1S/C13H22N4O2/c1-2-19-13(18)16-6-3-10(4-7-16)17-8-5-11(14)12(15)9-17/h5,9-10H,2-4,6-8,14-15H2,1H3 |
| InChIKey | RYOYLAHOLCQGFB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |