C14H19N3O2 — CID 70202678
3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-methoxybenzamide (PubChem CID 70202678) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-methoxybenzamide.
| Compound Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 70202678 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)cc1N1CC2CNCC2C1 |
| InChI | InChI=1S/C14H19N3O2/c1-19-13-3-2-9(14(15)18)4-12(13)17-7-10-5-16-6-11(10)8-17/h2-4,10-11,16H,5-8H2,1H3,(H2,15,18) |
| InChIKey | JHAXKAYUQHBISD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |