C23H20F3NO3S — CID 70203945
3-[8-[2-[[3-(trifluoromethyl)benzoyl]amino]ethyl]naphthalen-2-yl]sulfanylpropanoic acid (PubChem CID 70203945) has the molecular formula C23H20F3NO3S and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-[8-[2-[[3-(trifluoromethyl)benzoyl]amino]ethyl]naphthalen-2-yl]sulfanylpropanoic acid.
| Compound Name | 3-[8-[2-[[3-(trifluoromethyl)benzoyl]amino]ethyl]naphthalen-2-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 70203945 |
| Molecular Formula | C23H20F3NO3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-[8-[2-[[3-(trifluoromethyl)benzoyl]amino]ethyl]naphthalen-2-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSc1ccc2cccc(CCNC(=O)c3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C23H20F3NO3S/c24-23(25,26)18-6-2-5-17(13-18)22(30)27-11-9-16-4-1-3-15-7-8-19(14-20(15)16)31-12-10-21(28)29/h1-8,13-14H,9-12H2,(H,27,30)(H,28,29) |
| InChIKey | IKPBIVNOMQAAIG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |