C21H25FN4O4 — CID 70205919
ethyl 7-[6a-(aminomethyl)-3,3a,4,6-tetrahydro-2H-furo[2,3-c]pyrrol-5-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridine-3-carboxylate (PubChem CID 70205919) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is ethyl 7-[6a-(aminomethyl)-3,3a,4,6-tetrahydro-2H-furo[2,3-c]pyrrol-5-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-[6a-(aminomethyl)-3,3a,4,6-tetrahydro-2H-furo[2,3-c]pyrrol-5-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 70205919 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl 7-[6a-(aminomethyl)-3,3a,4,6-tetrahydro-2H-furo[2,3-c]pyrrol-5-yl]-1-cyclopropyl-8-fluoro-4-oxo-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(F)c(N3CC4CCOC4(CN)C3)ncc2c1=O |
| InChI | InChI=1S/C21H25FN4O4/c1-2-29-20(28)15-9-26(13-3-4-13)17-14(18(15)27)7-24-19(16(17)22)25-8-12-5-6-30-21(12,10-23)11-25/h7,9,12-13H,2-6,8,10-11,23H2,1H3 |
| InChIKey | MQPLUXRQXHVTNE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |