C17H19NO5 — CID 70212155
but-2-enedioic acid;2-methyl-3,3a,4,9b-tetrahydro-1H-benzo[e]isoindol-5-one (PubChem CID 70212155) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is but-2-enedioic acid;2-methyl-3,3a,4,9b-tetrahydro-1H-benzo[e]isoindol-5-one.
| Compound Name | but-2-enedioic acid;2-methyl-3,3a,4,9b-tetrahydro-1H-benzo[e]isoindol-5-one |
|---|---|
| PubChem CID | 70212155 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | but-2-enedioic acid;2-methyl-3,3a,4,9b-tetrahydro-1H-benzo[e]isoindol-5-one |
| SMILES | CN1CC2CC(=O)c3ccccc3C2C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H15NO.C4H4O4/c1-14-7-9-6-13(15)11-5-3-2-4-10(11)12(9)8-14;5-3(6)1-2-4(7)8/h2-5,9,12H,6-8H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RPANEUUBVAROKF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|