C15H28N2O3S — CID 70220162
ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[(2S)-thiolan-2-yl]propanoate (PubChem CID 70220162) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[(2S)-thiolan-2-yl]propanoate.
| Compound Name | ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[(2S)-thiolan-2-yl]propanoate |
|---|---|
| PubChem CID | 70220162 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[(2S)-thiolan-2-yl]propanoate |
| SMILES | CCOC(=O)C(C[C@@H]1CCCS1)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C15H28N2O3S/c1-4-20-15(19)13(9-11-6-5-7-21-11)17-14(18)12(16)8-10(2)3/h10-13H,4-9,16H2,1-3H3,(H,17,18)/t11-,12-,13?/m0/s1 |
| InChIKey | KJEAXGJZWBTGOL-VYAYZGMFSA-N |
| XLogP | 1.69 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |