C11H12O4 — CID 70227941
2-(2-ethoxyphenyl)-1,3-dioxol-4-ol (PubChem CID 70227941) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol.
| Compound Name | 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol |
|---|---|
| PubChem CID | 70227941 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol |
| SMILES | CCOc1ccccc1C1OC=C(O)O1 |
| InChI | InChI=1S/C11H12O4/c1-2-13-9-6-4-3-5-8(9)11-14-7-10(12)15-11/h3-7,11-12H,2H2,1H3 |
| InChIKey | RQPPKXLOSWIHKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |