About 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol
2-(2-ethoxyphenyl)-1,3-dioxol-4-ol (PubChem CID 70227941) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol.
Molecular Properties
| Compound Name | 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol |
| PubChem CID | 70227941 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol |
| SMILES | CCOc1ccccc1C1OC=C(O)O1 |
| InChI | InChI=1S/C11H12O4/c1-2-13-9-6-4-3-5-8(9)11-14-7-10(12)15-11/h3-7,11-12H,2H2,1H3 |
| InChIKey | RQPPKXLOSWIHKO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol?
The IUPAC name of 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol (CID 70227941) is 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol.
What is the SMILES notation for 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol?
The canonical SMILES for 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol is CCOc1ccccc1C1OC=C(O)O1.
What is the InChIKey of 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol?
The InChIKey is RQPPKXLOSWIHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-2-13-9-6-4-3-5-8(9)11-14-7-10(12)15-11/h3-7,11-12H,2H2,1H3.
What are the key properties of 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol?
2-(2-ethoxyphenyl)-1,3-dioxol-4-ol has a molecular weight of 208.21 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyphenyl)-1,3-dioxol-4-ol is sourced from PubChem (CID 70227941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).