C14H13Cl3N2O — CID 70229693
2-(4-chlorophenyl)-2-(2,6-dichloro-4-hydrazinylphenyl)ethanol (PubChem CID 70229693) has the molecular formula C14H13Cl3N2O and a molecular weight of 331.63 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2,6-dichloro-4-hydrazinylphenyl)ethanol.
| Compound Name | 2-(4-chlorophenyl)-2-(2,6-dichloro-4-hydrazinylphenyl)ethanol |
|---|---|
| PubChem CID | 70229693 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2,6-dichloro-4-hydrazinylphenyl)ethanol |
| SMILES | NNc1cc(Cl)c(C(CO)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl3N2O/c15-9-3-1-8(2-4-9)11(7-20)14-12(16)5-10(19-18)6-13(14)17/h1-6,11,19-20H,7,18H2 |
| InChIKey | AGFNTHKHZSTNFO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|