C15H25N7 — CID 70232922
2-N,4-N,8-N-tripropylpyrimido[5,4-d]pyrimidine-2,4,8-triamine (PubChem CID 70232922) has the molecular formula C15H25N7 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-N,4-N,8-N-tripropylpyrimido[5,4-d]pyrimidine-2,4,8-triamine.
| Compound Name | 2-N,4-N,8-N-tripropylpyrimido[5,4-d]pyrimidine-2,4,8-triamine |
|---|---|
| PubChem CID | 70232922 |
| Molecular Formula | C15H25N7 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-N,4-N,8-N-tripropylpyrimido[5,4-d]pyrimidine-2,4,8-triamine |
| SMILES | CCCNc1nc(NCCC)c2ncnc(NCCC)c2n1 |
| InChI | InChI=1S/C15H25N7/c1-4-7-16-13-12-11(19-10-20-13)14(17-8-5-2)22-15(21-12)18-9-6-3/h10H,4-9H2,1-3H3,(H,16,19,20)(H2,17,18,21,22) |
| InChIKey | LJRZFVPGYCJKHG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |