C25H24FN7O6 — CID 70233955
1-[2-[(4S)-4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furo[3,2-b]pyridin-5-yl]ethenyl N-amino-N'-ethylcarbamimidate (PubChem CID 70233955) has the molecular formula C25H24FN7O6 and a molecular weight of 537.51 g/mol. Its IUPAC name is 1-[2-[(4S)-4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furo[3,2-b]pyridin-5-yl]ethenyl N-amino-N'-ethylcarbamimidate.
| Compound Name | 1-[2-[(4S)-4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furo[3,2-b]pyridin-5-yl]ethenyl N-amino-N'-ethylcarbamimidate |
|---|---|
| PubChem CID | 70233955 |
| Molecular Formula | C25H24FN7O6 |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 1-[2-[(4S)-4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furo[3,2-b]pyridin-5-yl]ethenyl N-amino-N'-ethylcarbamimidate |
| SMILES | C=C(O/C(=N/CC)NN)c1ccc2oc([C@]3(CN4Cc5ccc(OC)c(F)c5C4=O)NC(=O)NC3=O)cc2n1 |
| InChI | InChI=1S/C25H24FN7O6/c1-4-28-24(32-27)38-12(2)14-6-8-16-15(29-14)9-18(39-16)25(22(35)30-23(36)31-25)11-33-10-13-5-7-17(37-3)20(26)19(13)21(33)34/h5-9H,2,4,10-11,27H2,1,3H3,(H,28,32)(H2,30,31,35,36)/t25-/m0/s1 |
| InChIKey | RIHQMFYHKKTWCI-VWLOTQADSA-N |
| XLogP | 1.49 |
| TPSA | 173.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|