C19H23F3N2O2 — CID 70235528
(3S)-3-amino-2-methyl-4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol (PubChem CID 70235528) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (3S)-3-amino-2-methyl-4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol.
| Compound Name | (3S)-3-amino-2-methyl-4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol |
|---|---|
| PubChem CID | 70235528 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3S)-3-amino-2-methyl-4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol |
| SMILES | CC(O)(CNCc1cccc(C(F)(F)F)c1)[C@@H](N)COc1ccccc1 |
| InChI | InChI=1S/C19H23F3N2O2/c1-18(25,17(23)12-26-16-8-3-2-4-9-16)13-24-11-14-6-5-7-15(10-14)19(20,21)22/h2-10,17,24-25H,11-13,23H2,1H3/t17-,18?/m0/s1 |
| InChIKey | OMVGHONJOFBPLX-ZENAZSQFSA-N |
| XLogP | 2.95 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |