C15H18N2O4 — CID 70242901
4-(4-aminophenyl)-2,6-dioxo-1-propylpiperidine-3-carboxylic acid (PubChem CID 70242901) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,6-dioxo-1-propylpiperidine-3-carboxylic acid.
| Compound Name | 4-(4-aminophenyl)-2,6-dioxo-1-propylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70242901 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-(4-aminophenyl)-2,6-dioxo-1-propylpiperidine-3-carboxylic acid |
| SMILES | CCCN1C(=O)CC(c2ccc(N)cc2)C(C(=O)O)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-2-7-17-12(18)8-11(13(14(17)19)15(20)21)9-3-5-10(16)6-4-9/h3-6,11,13H,2,7-8,16H2,1H3,(H,20,21) |
| InChIKey | URHJLYOYUYMELX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|