C34H38N4O6 — CID 70243024
tert-butyl N-[2-cyclohexa-2,4-dien-1-yl-1-[1-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-1-oxohexan-2-yl]-6-oxopyrimidin-5-yl]carbamate (PubChem CID 70243024) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is tert-butyl N-[2-cyclohexa-2,4-dien-1-yl-1-[1-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-1-oxohexan-2-yl]-6-oxopyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-cyclohexa-2,4-dien-1-yl-1-[1-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-1-oxohexan-2-yl]-6-oxopyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 70243024 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | tert-butyl N-[2-cyclohexa-2,4-dien-1-yl-1-[1-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-1-oxohexan-2-yl]-6-oxopyrimidin-5-yl]carbamate |
| SMILES | CCCCC(C(=O)N(CC1=CC=CC(=O)C1=O)c1ccccc1)n1c(C2C=CC=CC2)ncc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C34H38N4O6/c1-5-6-19-27(32(42)37(25-17-11-8-12-18-25)22-24-16-13-20-28(39)29(24)40)38-30(23-14-9-7-10-15-23)35-21-26(31(38)41)36-33(43)44-34(2,3)4/h7-14,16-18,20-21,23,27H,5-6,15,19,22H2,1-4H3,(H,36,43) |
| InChIKey | HLYLFXXNXWRUEG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|