C31H38N4O6 — CID 70239619
tert-butyl N-[1-[1-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methylamino]-1-oxononan-4-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate (PubChem CID 70239619) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methylamino]-1-oxononan-4-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methylamino]-1-oxononan-4-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 70239619 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | tert-butyl N-[1-[1-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methylamino]-1-oxononan-4-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
| SMILES | CCCCCC(CCC(=O)NCC1=CC=CC(=O)C1=O)n1c(-c2ccccc2)ncc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C31H38N4O6/c1-5-6-8-15-23(17-18-26(37)32-19-22-14-11-16-25(36)27(22)38)35-28(21-12-9-7-10-13-21)33-20-24(29(35)39)34-30(40)41-31(2,3)4/h7,9-14,16,20,23H,5-6,8,15,17-19H2,1-4H3,(H,32,37)(H,34,40) |
| InChIKey | OCNGVJGJLXNJKW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|