C31H32N4O4 — CID 174372633
2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)-phenylmethyl]octanamide (PubChem CID 174372633) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)-phenylmethyl]octanamide.
| Compound Name | 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)-phenylmethyl]octanamide |
|---|---|
| PubChem CID | 174372633 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 2-(5-amino-6-oxo-2-phenylpyrimidin-1-yl)-N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)-phenylmethyl]octanamide |
| SMILES | CCCCCCC(C(=O)NC(C1=CC=CC(=O)C1=O)c1ccccc1)n1c(-c2ccccc2)ncc(N)c1=O |
| InChI | InChI=1S/C31H32N4O4/c1-2-3-4-11-18-25(35-29(22-15-9-6-10-16-22)33-20-24(32)31(35)39)30(38)34-27(21-13-7-5-8-14-21)23-17-12-19-26(36)28(23)37/h5-10,12-17,19-20,25,27H,2-4,11,18,32H2,1H3,(H,34,38) |
| InChIKey | LQZSXXLVXFHNOY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|