C34H36N4O6 — CID 70243025
tert-butyl N-[1-[6-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-6-oxohexan-3-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate (PubChem CID 70243025) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-6-oxohexan-3-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-6-oxohexan-3-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 70243025 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | tert-butyl N-[1-[6-[N-[(5,6-dioxocyclohexa-1,3-dien-1-yl)methyl]anilino]-6-oxohexan-3-yl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
| SMILES | CCC(CCC(=O)N(CC1=CC=CC(=O)C1=O)c1ccccc1)n1c(-c2ccccc2)ncc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C34H36N4O6/c1-5-25(19-20-29(40)37(26-16-10-7-11-17-26)22-24-15-12-18-28(39)30(24)41)38-31(23-13-8-6-9-14-23)35-21-27(32(38)42)36-33(43)44-34(2,3)4/h6-18,21,25H,5,19-20,22H2,1-4H3,(H,36,43) |
| InChIKey | OXWHUMIUBHWHNO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|