C30H45N3O6 — CID 70244620
3-[[(2S)-1-[hex-5-enyl(methyl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]oct-7-enoic acid (PubChem CID 70244620) has the molecular formula C30H45N3O6 and a molecular weight of 543.71 g/mol. Its IUPAC name is 3-[[(2S)-1-[hex-5-enyl(methyl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]oct-7-enoic acid.
| Compound Name | 3-[[(2S)-1-[hex-5-enyl(methyl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]oct-7-enoic acid |
|---|---|
| PubChem CID | 70244620 |
| Molecular Formula | C30H45N3O6 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 3-[[(2S)-1-[hex-5-enyl(methyl)amino]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]oct-7-enoic acid |
| SMILES | C=CCCCCN(C)C(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)C(CCCC=C)CC(=O)O |
| InChI | InChI=1S/C30H45N3O6/c1-4-6-8-15-21-33(3)29(37)26(32-28(36)25(22-27(34)35)18-10-7-5-2)19-13-14-20-31-30(38)39-23-24-16-11-9-12-17-24/h4-5,9,11-12,16-17,25-26H,1-2,6-8,10,13-15,18-23H2,3H3,(H,31,38)(H,32,36)(H,34,35)/t25?,26-/m0/s1 |
| InChIKey | XIGJOYAYCJRHHZ-AMVUTOCUSA-N |
| XLogP | 4.83 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|