C26H27Cl2F3N2O4 — CID 70245534
propan-2-yl (2R,3S)-2-cyclopropyl-4-[(3,5-dichlorophenyl)methyl-methoxycarbonylamino]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-3-carboxylate (PubChem CID 70245534) has the molecular formula C26H27Cl2F3N2O4 and a molecular weight of 559.41 g/mol. Its IUPAC name is propan-2-yl (2R,3S)-2-cyclopropyl-4-[(3,5-dichlorophenyl)methyl-methoxycarbonylamino]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-3-carboxylate.
| Compound Name | propan-2-yl (2R,3S)-2-cyclopropyl-4-[(3,5-dichlorophenyl)methyl-methoxycarbonylamino]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 70245534 |
| Molecular Formula | C26H27Cl2F3N2O4 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | propan-2-yl (2R,3S)-2-cyclopropyl-4-[(3,5-dichlorophenyl)methyl-methoxycarbonylamino]-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline-3-carboxylate |
| SMILES | COC(=O)N(Cc1cc(Cl)cc(Cl)c1)C1c2cc(C(F)(F)F)ccc2N[C@H](C2CC2)[C@@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C26H27Cl2F3N2O4/c1-13(2)37-24(34)21-22(15-4-5-15)32-20-7-6-16(26(29,30)31)10-19(20)23(21)33(25(35)36-3)12-14-8-17(27)11-18(28)9-14/h6-11,13,15,21-23,32H,4-5,12H2,1-3H3/t21-,22+,23?/m0/s1 |
| InChIKey | RLQZQQHVCONIGR-ZVTBYLAHSA-N |
| XLogP | 7.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |