C20H23ClN2O3 — CID 70256806
ethyl 2-(4-chlorophenyl)-4-(cyclopropylmethoxy)-6-propan-2-ylpyrimidine-5-carboxylate (PubChem CID 70256806) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-4-(cyclopropylmethoxy)-6-propan-2-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(4-chlorophenyl)-4-(cyclopropylmethoxy)-6-propan-2-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 70256806 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-4-(cyclopropylmethoxy)-6-propan-2-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(OCC2CC2)nc(-c2ccc(Cl)cc2)nc1C(C)C |
| InChI | InChI=1S/C20H23ClN2O3/c1-4-25-20(24)16-17(12(2)3)22-18(14-7-9-15(21)10-8-14)23-19(16)26-11-13-5-6-13/h7-10,12-13H,4-6,11H2,1-3H3 |
| InChIKey | AEDDYEWFXJMTKV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |