C11H14ClNO3 — CID 70258418
(2S)-2-acetamido-3-(4-chlorocyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 70258418) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(4-chlorocyclohexa-2,4-dien-1-yl)propanoic acid.
| Compound Name | (2S)-2-acetamido-3-(4-chlorocyclohexa-2,4-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 70258418 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2S)-2-acetamido-3-(4-chlorocyclohexa-2,4-dien-1-yl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CC1C=CC(Cl)=CC1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO3/c1-7(14)13-10(11(15)16)6-8-2-4-9(12)5-3-8/h2,4-5,8,10H,3,6H2,1H3,(H,13,14)(H,15,16)/t8?,10-/m0/s1 |
| InChIKey | JIKMFPSVWIFTIB-HTLJXXAVSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |