C13H17ClN2O5 — CID 70539560
(2S)-2-[[2-[(2-chloroacetyl)amino]acetyl]amino]-3-(4-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 70539560) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-chloroacetyl)amino]acetyl]amino]-3-(4-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid.
| Compound Name | (2S)-2-[[2-[(2-chloroacetyl)amino]acetyl]amino]-3-(4-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 70539560 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2S)-2-[[2-[(2-chloroacetyl)amino]acetyl]amino]-3-(4-hydroxycyclohexa-2,4-dien-1-yl)propanoic acid |
| SMILES | O=C(CCl)NCC(=O)N[C@@H](CC1C=CC(O)=CC1)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O5/c14-6-11(18)15-7-12(19)16-10(13(20)21)5-8-1-3-9(17)4-2-8/h1,3-4,8,10,17H,2,5-7H2,(H,15,18)(H,16,19)(H,20,21)/t8?,10-/m0/s1 |
| InChIKey | WYTKSAJIANNHLW-HTLJXXAVSA-N |
| XLogP | 0.32 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|