C11H14ClNO4 — CID 22217614
2-acetamido-3-(4-chloro-4-hydroxycyclohexa-2,5-dien-1-yl)propanoic acid (PubChem CID 22217614) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-acetamido-3-(4-chloro-4-hydroxycyclohexa-2,5-dien-1-yl)propanoic acid.
| Compound Name | 2-acetamido-3-(4-chloro-4-hydroxycyclohexa-2,5-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 22217614 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-acetamido-3-(4-chloro-4-hydroxycyclohexa-2,5-dien-1-yl)propanoic acid |
| SMILES | CC(=O)NC(CC1C=CC(O)(Cl)C=C1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO4/c1-7(14)13-9(10(15)16)6-8-2-4-11(12,17)5-3-8/h2-5,8-9,17H,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | HGDJQYVVVUWPBA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|