C33H42FN5O9 — CID 70260202
bis(but-2-enedioic acid);N-cyclohexyl-4-[3-(4-fluoro-N-pyridin-2-ylanilino)propyl]piperazine-1-carboxamide (PubChem CID 70260202) has the molecular formula C33H42FN5O9 and a molecular weight of 671.72 g/mol. Its IUPAC name is bis(but-2-enedioic acid);N-cyclohexyl-4-[3-(4-fluoro-N-pyridin-2-ylanilino)propyl]piperazine-1-carboxamide.
| Compound Name | bis(but-2-enedioic acid);N-cyclohexyl-4-[3-(4-fluoro-N-pyridin-2-ylanilino)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70260202 |
| Molecular Formula | C33H42FN5O9 |
| Molecular Weight | 671.72 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | bis(but-2-enedioic acid);N-cyclohexyl-4-[3-(4-fluoro-N-pyridin-2-ylanilino)propyl]piperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(CCCN(c2ccc(F)cc2)c2ccccn2)CC1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C25H34FN5O.2C4H4O4/c26-21-10-12-23(13-11-21)31(24-9-4-5-14-27-24)16-6-15-29-17-19-30(20-18-29)25(32)28-22-7-2-1-3-8-22;2*5-3(6)1-2-4(7)8/h4-5,9-14,22H,1-3,6-8,15-20H2,(H,28,32);2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | LQBMDJRKNILPPB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 200.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|