C26H30N4O3 — CID 70269309
benzyl N-[3-[5-[2-[2-(dimethylamino)ethylideneamino]-2-oxoethyl]-1H-indol-3-yl]cyclobutyl]carbamate (PubChem CID 70269309) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl N-[3-[5-[2-[2-(dimethylamino)ethylideneamino]-2-oxoethyl]-1H-indol-3-yl]cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[5-[2-[2-(dimethylamino)ethylideneamino]-2-oxoethyl]-1H-indol-3-yl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 70269309 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | benzyl N-[3-[5-[2-[2-(dimethylamino)ethylideneamino]-2-oxoethyl]-1H-indol-3-yl]cyclobutyl]carbamate |
| SMILES | CN(C)C/C=N/C(=O)Cc1ccc2[nH]cc(C3CC(NC(=O)OCc4ccccc4)C3)c2c1 |
| InChI | InChI=1S/C26H30N4O3/c1-30(2)11-10-27-25(31)13-19-8-9-24-22(12-19)23(16-28-24)20-14-21(15-20)29-26(32)33-17-18-6-4-3-5-7-18/h3-10,12,16,20-21,28H,11,13-15,17H2,1-2H3,(H,29,32)/b27-10+ |
| InChIKey | FUDUNRZHTPACRK-YPXUMCKCSA-N |
| XLogP | 4.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|