C29H25ClN2O5S — CID 70269768
[2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl] N-(2-chlorophenyl)carbamate (PubChem CID 70269768) has the molecular formula C29H25ClN2O5S and a molecular weight of 549.05 g/mol. Its IUPAC name is [2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl] N-(2-chlorophenyl)carbamate.
| Compound Name | [2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl] N-(2-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 70269768 |
| Molecular Formula | C29H25ClN2O5S |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | [2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl] N-(2-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1Cl)OCC(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H25ClN2O5S/c30-26-13-7-8-14-27(26)31-29(34)37-21-28(33)24-15-17-25(18-16-24)38(35,36)32(19-22-9-3-1-4-10-22)20-23-11-5-2-6-12-23/h1-18H,19-21H2,(H,31,34) |
| InChIKey | HERFSGWCCWYKLE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |