C30H28N2O5S — CID 70266385
[4-[2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl]-2-methylphenyl]carbamic acid (PubChem CID 70266385) has the molecular formula C30H28N2O5S and a molecular weight of 528.63 g/mol. Its IUPAC name is [4-[2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl]-2-methylphenyl]carbamic acid.
| Compound Name | [4-[2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl]-2-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 70266385 |
| Molecular Formula | C30H28N2O5S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [4-[2-[4-(dibenzylsulfamoyl)phenyl]-2-oxoethyl]-2-methylphenyl]carbamic acid |
| SMILES | Cc1cc(CC(=O)c2ccc(S(=O)(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)ccc1NC(=O)O |
| InChI | InChI=1S/C30H28N2O5S/c1-22-18-25(12-17-28(22)31-30(34)35)19-29(33)26-13-15-27(16-14-26)38(36,37)32(20-23-8-4-2-5-9-23)21-24-10-6-3-7-11-24/h2-18,31H,19-21H2,1H3,(H,34,35) |
| InChIKey | OLSMJWRQBSTTCW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |