C28H24Cl2N2O3S — CID 140994525
4-[2-(6-amino-2,3-dichlorophenyl)acetyl]-N,N-dibenzylbenzenesulfonamide (PubChem CID 140994525) has the molecular formula C28H24Cl2N2O3S and a molecular weight of 539.48 g/mol. Its IUPAC name is 4-[2-(6-amino-2,3-dichlorophenyl)acetyl]-N,N-dibenzylbenzenesulfonamide.
| Compound Name | 4-[2-(6-amino-2,3-dichlorophenyl)acetyl]-N,N-dibenzylbenzenesulfonamide |
|---|---|
| PubChem CID | 140994525 |
| Molecular Formula | C28H24Cl2N2O3S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-[2-(6-amino-2,3-dichlorophenyl)acetyl]-N,N-dibenzylbenzenesulfonamide |
| SMILES | Nc1ccc(Cl)c(Cl)c1CC(=O)c1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24Cl2N2O3S/c29-25-15-16-26(31)24(28(25)30)17-27(33)22-11-13-23(14-12-22)36(34,35)32(18-20-7-3-1-4-8-20)19-21-9-5-2-6-10-21/h1-16H,17-19,31H2 |
| InChIKey | LNFIUIWRDQEKLJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|