C28H27N3O6 — CID 70270395
4-[(2S,3S)-1-amino-4-oxo-3-[(2S)-3-phenyl-2-(3-phenylpropanoylamino)propanoyl]azetidin-2-yl]oxybenzoic acid (PubChem CID 70270395) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is 4-[(2S,3S)-1-amino-4-oxo-3-[(2S)-3-phenyl-2-(3-phenylpropanoylamino)propanoyl]azetidin-2-yl]oxybenzoic acid.
| Compound Name | 4-[(2S,3S)-1-amino-4-oxo-3-[(2S)-3-phenyl-2-(3-phenylpropanoylamino)propanoyl]azetidin-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 70270395 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 4-[(2S,3S)-1-amino-4-oxo-3-[(2S)-3-phenyl-2-(3-phenylpropanoylamino)propanoyl]azetidin-2-yl]oxybenzoic acid |
| SMILES | NN1C(=O)[C@H](C(=O)[C@H](Cc2ccccc2)NC(=O)CCc2ccccc2)[C@@H]1Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H27N3O6/c29-31-26(34)24(27(31)37-21-14-12-20(13-15-21)28(35)36)25(33)22(17-19-9-5-2-6-10-19)30-23(32)16-11-18-7-3-1-4-8-18/h1-10,12-15,22,24,27H,11,16-17,29H2,(H,30,32)(H,35,36)/t22-,24-,27-/m0/s1 |
| InChIKey | LCSZNDNDCVDLJR-DPPGTGKWSA-N |
| XLogP | 2.35 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|