C15H15NO3S2 — CID 70271001
2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-6-yl)oxy]ethyl acetate (PubChem CID 70271001) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-6-yl)oxy]ethyl acetate.
| Compound Name | 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-6-yl)oxy]ethyl acetate |
|---|---|
| PubChem CID | 70271001 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[(2-sulfanylidene-4,5-dihydro-1H-benzo[e][1,3]benzothiazol-6-yl)oxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1cccc2c1CCc1sc(=S)[nH]c1-2 |
| InChI | InChI=1S/C15H15NO3S2/c1-9(17)18-7-8-19-12-4-2-3-11-10(12)5-6-13-14(11)16-15(20)21-13/h2-4H,5-8H2,1H3,(H,16,20) |
| InChIKey | DIYXUBDFMBPFCS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|