C12H8NO3S2- — CID 18471080
2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-5-yl)oxy]acetate (PubChem CID 18471080) has the molecular formula C12H8NO3S2- and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-5-yl)oxy]acetate.
| Compound Name | 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-5-yl)oxy]acetate |
|---|---|
| PubChem CID | 18471080 |
| Molecular Formula | C12H8NO3S2- |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-[(2-sulfanylidene-1,4-dihydroindeno[1,2-d][1,3]thiazol-5-yl)oxy]acetate |
| SMILES | O=C([O-])COc1cccc2c1Cc1sc(=S)[nH]c1-2 |
| InChI | InChI=1S/C12H9NO3S2/c14-10(15)5-16-8-3-1-2-6-7(8)4-9-11(6)13-12(17)18-9/h1-3H,4-5H2,(H,13,17)(H,14,15)/p-1 |
| InChIKey | ICUGZMYFBZMKMR-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|