C21H33N5O2 — CID 70273027
1-N-[4-(diaminomethylideneamino)butyl]-1-N'-methyl-1-N'-(2-phenylethyl)cyclopentane-1,1-dicarboxamide (PubChem CID 70273027) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-methyl-1-N'-(2-phenylethyl)cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-methyl-1-N'-(2-phenylethyl)cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 70273027 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-methyl-1-N'-(2-phenylethyl)cyclopentane-1,1-dicarboxamide |
| SMILES | CN(CCc1ccccc1)C(=O)C1(C(=O)NCCCCN=C(N)N)CCCC1 |
| InChI | InChI=1S/C21H33N5O2/c1-26(16-11-17-9-3-2-4-10-17)19(28)21(12-5-6-13-21)18(27)24-14-7-8-15-25-20(22)23/h2-4,9-10H,5-8,11-16H2,1H3,(H,24,27)(H4,22,23,25) |
| InChIKey | DRIMPDXUXNVVPI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|