C50H64BN6O6 — CID 70273085
CID 70273085 (PubChem CID 70273085) has the molecular formula C50H64BN6O6 and a molecular weight of 855.91 g/mol.
| Compound Name | CID 70273085 |
|---|---|
| PubChem CID | 70273085 |
| Molecular Formula | C50H64BN6O6 |
| Molecular Weight | 855.91 g/mol |
| Exact Mass | 855.50 |
| IUPAC Name | — |
| SMILES | NCCCC(NC(=O)C1(C(=O)NCC(c2ccccc2)c2ccccc2)CCCC1)O[B]OC(CCCN)NC(=O)C1(C(=O)NCC(c2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C50H64BN6O6/c52-33-17-27-43(56-47(60)49(29-13-14-30-49)45(58)54-35-41(37-19-5-1-6-20-37)38-21-7-2-8-22-38)62-51-63-44(28-18-34-53)57-48(61)50(31-15-16-32-50)46(59)55-36-42(39-23-9-3-10-24-39)40-25-11-4-12-26-40/h1-12,19-26,41-44H,13-18,27-36,52-53H2,(H,54,58)(H,55,59)(H,56,60)(H,57,61) |
| InChIKey | SOIMBFSUFGKTSC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|