C10H7BrF3NO2 — CID 70274720
4-bromo-2-[2-(trifluoromethyl)phenyl]-1,2-oxazolidin-3-one (PubChem CID 70274720) has the molecular formula C10H7BrF3NO2 and a molecular weight of 310.07 g/mol. Its IUPAC name is 4-bromo-2-[2-(trifluoromethyl)phenyl]-1,2-oxazolidin-3-one.
| Compound Name | 4-bromo-2-[2-(trifluoromethyl)phenyl]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 70274720 |
| Molecular Formula | C10H7BrF3NO2 |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 4-bromo-2-[2-(trifluoromethyl)phenyl]-1,2-oxazolidin-3-one |
| SMILES | O=C1C(Br)CON1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H7BrF3NO2/c11-7-5-17-15(9(7)16)8-4-2-1-3-6(8)10(12,13)14/h1-4,7H,5H2 |
| InChIKey | FONOZDGMTJJXLR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|