C15H12Cl3N3O2 — CID 70282688
(E)-1-N-[(3-chlorophenyl)methyl]-1-N'-(3,5-dichlorophenyl)-2-nitroethene-1,1-diamine (PubChem CID 70282688) has the molecular formula C15H12Cl3N3O2 and a molecular weight of 372.64 g/mol. Its IUPAC name is (E)-1-N-[(3-chlorophenyl)methyl]-1-N'-(3,5-dichlorophenyl)-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N-[(3-chlorophenyl)methyl]-1-N'-(3,5-dichlorophenyl)-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 70282688 |
| Molecular Formula | C15H12Cl3N3O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | (E)-1-N-[(3-chlorophenyl)methyl]-1-N'-(3,5-dichlorophenyl)-2-nitroethene-1,1-diamine |
| SMILES | O=[N+]([O-])/C=C(\NCc1cccc(Cl)c1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H12Cl3N3O2/c16-11-3-1-2-10(4-11)8-19-15(9-21(22)23)20-14-6-12(17)5-13(18)7-14/h1-7,9,19-20H,8H2/b15-9+ |
| InChIKey | VCGAJSZVUQLFFD-OQLLNIDSSA-N |
| XLogP | 4.92 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|